C10H5F11O — CID 58782398
5-(1,1-difluoropropoxy)-1,2,3,4,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene (PubChem CID 58782398) has the molecular formula C10H5F11O and a molecular weight of 350.13 g/mol. Its IUPAC name is 5-(1,1-difluoropropoxy)-1,2,3,4,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1-difluoropropoxy)-1,2,3,4,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58782398 |
| Molecular Formula | C10H5F11O |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 5-(1,1-difluoropropoxy)-1,2,3,4,5,6,6,7,7-nonafluorobicyclo[2.2.1]hept-2-ene |
| SMILES | CCC(F)(F)OC1(F)C(F)(F)C2(F)C(F)=C(F)C1(F)C2(F)F |
| InChI | InChI=1S/C10H5F11O/c1-2-5(13,14)22-10(21)7(16)4(12)3(11)6(15,8(7,17)18)9(10,19)20/h2H2,1H3 |
| InChIKey | MFYRNVQVXQMJHR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |