C75H58 — CID 58782810
9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-3-methylanthracen-9-yl]-2-methylanthracene (PubChem CID 58782810) has the molecular formula C75H58 and a molecular weight of 959.29 g/mol. Its IUPAC name is 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-3-methylanthracen-9-yl]-2-methylanthracene.
| Compound Name | 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-3-methylanthracen-9-yl]-2-methylanthracene |
|---|---|
| PubChem CID | 58782810 |
| Molecular Formula | C75H58 |
| Molecular Weight | 959.29 g/mol |
| Exact Mass | 958.45 |
| IUPAC Name | 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-3-methylanthracen-9-yl]-2-methylanthracene |
| SMILES | Cc1ccc2c(-c3c4ccccc4c(-c4ccc5c(c4)C(C)(C)c4cc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)ccc4-5)c4cc(C)ccc34)c3ccccc3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2c1 |
| InChI | InChI=1S/C75H58/c1-43-25-31-59-61(37-43)69(47-29-35-52-50-18-14-16-24-64(50)74(5,6)67(52)41-47)55-19-9-11-21-57(55)71(59)72-58-22-12-10-20-56(58)70(62-38-44(2)26-32-60(62)72)48-30-36-54-53-34-28-46(40-66(53)75(7,8)68(54)42-48)45-27-33-51-49-17-13-15-23-63(49)73(3,4)65(51)39-45/h9-42H,1-8H3 |
| InChIKey | CWENCULSSZLXEO-UHFFFAOYSA-N |
| XLogP | 20.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.29 |
| LogP ≤ 5 | 20.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|