C24H21O3PS5 — CID 58782878
4-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]butylphosphonic acid (PubChem CID 58782878) has the molecular formula C24H21O3PS5 and a molecular weight of 548.74 g/mol. Its IUPAC name is 4-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]butylphosphonic acid.
| Compound Name | 4-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]butylphosphonic acid |
|---|---|
| PubChem CID | 58782878 |
| Molecular Formula | C24H21O3PS5 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | 4-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]butylphosphonic acid |
| SMILES | O=P(O)(O)CCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5cccs5)s4)s3)s2)s1 |
| InChI | InChI=1S/C24H21O3PS5/c25-28(26,27)14-2-1-4-16-6-7-19(30-16)20-10-11-23(32-20)24-13-12-22(33-24)21-9-8-18(31-21)17-5-3-15-29-17/h3,5-13,15H,1-2,4,14H2,(H2,25,26,27) |
| InChIKey | FTBGMAOYLXOXIJ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|