C16H23NaO6S — CID 58782979
sodium 4-[6-(2-hydroxyethoxy)-5,5-dimethyl-6-oxohexan-3-yl]benzenesulfonate (PubChem CID 58782979) has the molecular formula C16H23NaO6S and a molecular weight of 366.41 g/mol. Its IUPAC name is sodium 4-[6-(2-hydroxyethoxy)-5,5-dimethyl-6-oxohexan-3-yl]benzenesulfonate.
| Compound Name | sodium 4-[6-(2-hydroxyethoxy)-5,5-dimethyl-6-oxohexan-3-yl]benzenesulfonate |
|---|---|
| PubChem CID | 58782979 |
| Molecular Formula | C16H23NaO6S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | sodium 4-[6-(2-hydroxyethoxy)-5,5-dimethyl-6-oxohexan-3-yl]benzenesulfonate |
| SMILES | CCC(CC(C)(C)C(=O)OCCO)c1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C16H24O6S.Na/c1-4-12(11-16(2,3)15(18)22-10-9-17)13-5-7-14(8-6-13)23(19,20)21;/h5-8,12,17H,4,9-11H2,1-3H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | ARWYEUNRAWQRTD-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|