C12H15N3O6 — CID 58782997
1-(oxiran-2-yl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazepane-2,4,6-trione (PubChem CID 58782997) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 1-(oxiran-2-yl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazepane-2,4,6-trione.
| Compound Name | 1-(oxiran-2-yl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazepane-2,4,6-trione |
|---|---|
| PubChem CID | 58782997 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-(oxiran-2-yl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazepane-2,4,6-trione |
| SMILES | O=C1CN(C2CO2)C(=O)N(CC2CO2)C(=O)N1CC1CO1 |
| InChI | InChI=1S/C12H15N3O6/c16-9-3-14(10-6-21-10)12(18)15(2-8-5-20-8)11(17)13(9)1-7-4-19-7/h7-8,10H,1-6H2 |
| InChIKey | CDXJLKREJYVKBB-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|