C26H44O3SSi — CID 58783113
[(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane (PubChem CID 58783113) has the molecular formula C26H44O3SSi and a molecular weight of 464.79 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 58783113 |
| Molecular Formula | C26H44O3SSi |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CCS(=O)(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C26H44O3SSi/c1-6-31(7-2,8-3)29-25-15-12-19-26(5)23(16-17-24(25)26)21(4)18-20-30(27,28)22-13-10-9-11-14-22/h9-11,13-14,21,23-25H,6-8,12,15-20H2,1-5H3/t21-,23-,24+,25+,26-/m1/s1 |
| InChIKey | RKQNUSOAZOHEBE-BMLQBVLXSA-N |
| XLogP | 7.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|