C19H34S — CID 58783150
(3aS,7S,7aS)-3-[(2R)-4-tert-butylsulfanylbutan-2-yl]-3a,7-dimethyl-1,4,5,6,7,7a-hexahydroindene (PubChem CID 58783150) has the molecular formula C19H34S and a molecular weight of 294.55 g/mol. Its IUPAC name is (3aS,7S,7aS)-3-[(2R)-4-tert-butylsulfanylbutan-2-yl]-3a,7-dimethyl-1,4,5,6,7,7a-hexahydroindene.
| Compound Name | (3aS,7S,7aS)-3-[(2R)-4-tert-butylsulfanylbutan-2-yl]-3a,7-dimethyl-1,4,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 58783150 |
| Molecular Formula | C19H34S |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (3aS,7S,7aS)-3-[(2R)-4-tert-butylsulfanylbutan-2-yl]-3a,7-dimethyl-1,4,5,6,7,7a-hexahydroindene |
| SMILES | C[C@H](CCSC(C)(C)C)C1=CC[C@H]2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C19H34S/c1-14-8-7-12-19(6)16(14)9-10-17(19)15(2)11-13-20-18(3,4)5/h10,14-16H,7-9,11-13H2,1-6H3/t14-,15+,16-,19-/m0/s1 |
| InChIKey | BFVVMHDAQKVQKG-RCJHGTSTSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|