C21H28NO3+ — CID 58783313
(14S)-9-methoxy-4,7-dimethyl-4-prop-2-enyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 58783313) has the molecular formula C21H28NO3+ and a molecular weight of 342.46 g/mol. Its IUPAC name is (14S)-9-methoxy-4,7-dimethyl-4-prop-2-enyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (14S)-9-methoxy-4,7-dimethyl-4-prop-2-enyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 58783313 |
| Molecular Formula | C21H28NO3+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (14S)-9-methoxy-4,7-dimethyl-4-prop-2-enyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | C=CC[N+]1(C)CCC23C=C[C@@H](O)CC2Oc2c(OC)cc(C)c(c23)C1 |
| InChI | InChI=1S/C21H28NO3/c1-5-9-22(3)10-8-21-7-6-15(23)12-18(21)25-20-17(24-4)11-14(2)16(13-22)19(20)21/h5-7,11,15,18,23H,1,8-10,12-13H2,2-4H3/q+1/t15-,18?,21?,22?/m1/s1 |
| InChIKey | JORNYAXFZCQOJV-XMVWEPJVSA-N |
| XLogP | 2.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|