About 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol
2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol (PubChem CID 587836) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol |
| PubChem CID | 587836 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol |
| SMILES | Cc1cc(C)nc(SCCO)n1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-5-7(2)10-8(9-6)12-4-3-11/h5,11H,3-4H2,1-2H3 |
| InChIKey | DSRGZRHOYJEVPF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol (CID 587836) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol is Cc1cc(C)nc(SCCO)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol?
The InChIKey is DSRGZRHOYJEVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-6-5-7(2)10-8(9-6)12-4-3-11/h5,11H,3-4H2,1-2H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol?
2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol has a molecular weight of 184.26 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanol is sourced from PubChem (CID 587836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).