C23H27F3N6O3 — CID 58783667
3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide (PubChem CID 58783667) has the molecular formula C23H27F3N6O3 and a molecular weight of 492.50 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide.
| Compound Name | 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 58783667 |
| Molecular Formula | C23H27F3N6O3 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide |
| SMILES | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)c1nnc2cccc(C(=O)NCCC(F)(F)F)n12 |
| InChI | InChI=1S/C23H27F3N6O3/c1-22(2,27)21(34)29-16(14-35-13-15-7-4-3-5-8-15)19-31-30-18-10-6-9-17(32(18)19)20(33)28-12-11-23(24,25)26/h3-10,16H,11-14,27H2,1-2H3,(H,28,33)(H,29,34)/t16-/m1/s1 |
| InChIKey | PLAKCNAOCJDMBY-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |