C20H29N5O2 — CID 58783725
2-amino-2-methyl-N-[(1S)-1-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-phenylmethoxyethyl]propanamide (PubChem CID 58783725) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[(1S)-1-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-phenylmethoxyethyl]propanamide.
| Compound Name | 2-amino-2-methyl-N-[(1S)-1-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-phenylmethoxyethyl]propanamide |
|---|---|
| PubChem CID | 58783725 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 2-amino-2-methyl-N-[(1S)-1-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-phenylmethoxyethyl]propanamide |
| SMILES | CC1CCCc2nnc([C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)n21 |
| InChI | InChI=1S/C20H29N5O2/c1-14-8-7-11-17-23-24-18(25(14)17)16(22-19(26)20(2,3)21)13-27-12-15-9-5-4-6-10-15/h4-6,9-10,14,16H,7-8,11-13,21H2,1-3H3,(H,22,26)/t14?,16-/m1/s1 |
| InChIKey | VVQPASJPBPYPCK-BZSJEYESSA-N |
| XLogP | 2.29 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |