About 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine
3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine (PubChem CID 58784017) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine |
| PubChem CID | 58784017 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine |
| SMILES | CC(C)c1noc2ccncc12 |
| InChI | InChI=1S/C9H10N2O/c1-6(2)9-7-5-10-4-3-8(7)12-11-9/h3-6H,1-2H3 |
| InChIKey | QBUDHRXWGOBQFX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine?
The IUPAC name of 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine (CID 58784017) is 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine.
What is the SMILES notation for 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine?
The canonical SMILES for 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine is CC(C)c1noc2ccncc12.
What is the InChIKey of 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine?
The InChIKey is QBUDHRXWGOBQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-6(2)9-7-5-10-4-3-8(7)12-11-9/h3-6H,1-2H3.
What are the key properties of 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine?
3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine has a molecular weight of 162.19 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-[1,2]oxazolo[4,5-c]pyridine is sourced from PubChem (CID 58784017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).