C24H29F3N6O4 — CID 58784018
[3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl N-(3,3,3-trifluoropropyl)carbamate (PubChem CID 58784018) has the molecular formula C24H29F3N6O4 and a molecular weight of 522.53 g/mol. Its IUPAC name is [3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl N-(3,3,3-trifluoropropyl)carbamate.
| Compound Name | [3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl N-(3,3,3-trifluoropropyl)carbamate |
|---|---|
| PubChem CID | 58784018 |
| Molecular Formula | C24H29F3N6O4 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | [3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methyl N-(3,3,3-trifluoropropyl)carbamate |
| SMILES | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)c1nnc2ccc(COC(=O)NCCC(F)(F)F)cn12 |
| InChI | InChI=1S/C24H29F3N6O4/c1-23(2,28)21(34)30-18(15-36-13-16-6-4-3-5-7-16)20-32-31-19-9-8-17(12-33(19)20)14-37-22(35)29-11-10-24(25,26)27/h3-9,12,18H,10-11,13-15,28H2,1-2H3,(H,29,35)(H,30,34)/t18-/m1/s1 |
| InChIKey | GBTKKHJJNDYWNP-GOSISDBHSA-N |
| XLogP | 3.02 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |