About [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium)
[6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) (PubChem CID 58784383) has the molecular formula C6H2N2O2Y2-2
and a molecular weight of 311.91 g/mol. Its IUPAC name is [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium).
Molecular Properties
| Compound Name | [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) |
| PubChem CID | 58784383 |
| Molecular Formula | C6H2N2O2Y2-2 |
| Molecular Weight | 311.91 g/mol |
| Exact Mass | 311.82 |
| IUPAC Name | [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) |
| SMILES | O=[C-]c1cc([C-]=O)ncn1.[Y].[Y] |
| InChI | InChI=1S/C6H2N2O2.2Y/c9-2-5-1-6(3-10)8-4-7-5;;/h1,4H;;/q-2;; |
| InChIKey | PKGVSCCSQRNNAL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.91 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium)?
The IUPAC name of [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) (CID 58784383) is [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium).
What is the SMILES notation for [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium)?
The canonical SMILES for [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) is O=[C-]c1cc([C-]=O)ncn1.[Y].[Y].
What is the InChIKey of [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium)?
The InChIKey is PKGVSCCSQRNNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N2O2.2Y/c9-2-5-1-6(3-10)8-4-7-5;;/h1,4H;;/q-2;;.
What are the key properties of [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium)?
[6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) has a molecular weight of 311.91 g/mol, XLogP of -0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(oxomethyl)pyrimidin-4-yl]methanone;bis(yttrium) is sourced from PubChem (CID 58784383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).