About 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid
5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid (PubChem CID 58784635) has the molecular formula C19H11Cl2N3O2S
and a molecular weight of 416.29 g/mol. Its IUPAC name is 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid |
| PubChem CID | 58784635 |
| Molecular Formula | C19H11Cl2N3O2S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cc(-c3cccnc3)nn2-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C19H11Cl2N3O2S/c20-13-4-3-12(8-14(13)21)24-16(17-5-6-18(27-17)19(25)26)9-15(23-24)11-2-1-7-22-10-11/h1-10H,(H,25,26) |
| InChIKey | PJOTYRIAZFICKQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid (CID 58784635) is 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid is O=C(O)c1ccc(-c2cc(-c3cccnc3)nn2-c2ccc(Cl)c(Cl)c2)s1.
What is the InChIKey of 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid?
The InChIKey is PJOTYRIAZFICKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl2N3O2S/c20-13-4-3-12(8-14(13)21)24-16(17-5-6-18(27-17)19(25)26)9-15(23-24)11-2-1-7-22-10-11/h1-10H,(H,25,26).
What are the key properties of 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid?
5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid has a molecular weight of 416.29 g/mol, XLogP of 5.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxylic acid is sourced from PubChem (CID 58784635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).