About 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium)
3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) (PubChem CID 58784929) has the molecular formula C8H9NY5-2
and a molecular weight of 563.70 g/mol. Its IUPAC name is 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium).
Molecular Properties
| Compound Name | 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) |
| PubChem CID | 58784929 |
| Molecular Formula | C8H9NY5-2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.60 |
| IUPAC Name | 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) |
| SMILES | Cc1[c-]cc(N)[c-]c1C.[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C8H9N.5Y/c1-6-3-4-8(9)5-7(6)2;;;;;/h4H,9H2,1-2H3;;;;;/q-2;;;;; |
| InChIKey | FQKBDWZUFGIFMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium)?
The IUPAC name of 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) (CID 58784929) is 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium).
What is the SMILES notation for 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium)?
The canonical SMILES for 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) is Cc1[c-]cc(N)[c-]c1C.[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium)?
The InChIKey is FQKBDWZUFGIFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.5Y/c1-6-3-4-8(9)5-7(6)2;;;;;/h4H,9H2,1-2H3;;;;;/q-2;;;;;.
What are the key properties of 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium)?
3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) has a molecular weight of 563.70 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylbenzene-2,5-diid-1-amine;pentakis(yttrium) is sourced from PubChem (CID 58784929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).