About (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one
(3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one (PubChem CID 58785337) has the molecular formula C7H6O2
and a molecular weight of 122.12 g/mol. Its IUPAC name is (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one.
Molecular Properties
| Compound Name | (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| PubChem CID | 58785337 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| SMILES | O=C1C=CC=C[C@]12CO2 |
| InChI | InChI=1S/C7H6O2/c8-6-3-1-2-4-7(6)5-9-7/h1-4H,5H2/t7-/m0/s1 |
| InChIKey | MLSDCPNDMOZXCC-ZETCQYMHSA-N |
| XLogP | 0.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The IUPAC name of (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one (CID 58785337) is (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one.
What is the SMILES notation for (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The canonical SMILES for (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one is O=C1C=CC=C[C@]12CO2.
What is the InChIKey of (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one?
The InChIKey is MLSDCPNDMOZXCC-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H6O2/c8-6-3-1-2-4-7(6)5-9-7/h1-4H,5H2/t7-/m0/s1.
What are the key properties of (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one?
(3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one has a molecular weight of 122.12 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-oxaspiro[2.5]octa-5,7-dien-4-one is sourced from PubChem (CID 58785337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).