C30H20Cl2N2O6S — CID 58785354
(2R,3'R,4'S,5'R)-5'-(3,4-dichlorophenyl)-5-methyl-1,3-dioxo-4'-[[4-(1,3-thiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 58785354) has the molecular formula C30H20Cl2N2O6S and a molecular weight of 607.47 g/mol. Its IUPAC name is (2R,3'R,4'S,5'R)-5'-(3,4-dichlorophenyl)-5-methyl-1,3-dioxo-4'-[[4-(1,3-thiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | (2R,3'R,4'S,5'R)-5'-(3,4-dichlorophenyl)-5-methyl-1,3-dioxo-4'-[[4-(1,3-thiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 58785354 |
| Molecular Formula | C30H20Cl2N2O6S |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | (2R,3'R,4'S,5'R)-5'-(3,4-dichlorophenyl)-5-methyl-1,3-dioxo-4'-[[4-(1,3-thiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | Cc1ccc2c(c1)C(=O)[C@]1(O[C@@H](c3ccc(Cl)c(Cl)c3)[C@@H](C(=O)Nc3ccc(-c4cscn4)cc3)[C@H]1C(=O)O)C2=O |
| InChI | InChI=1S/C30H20Cl2N2O6S/c1-14-2-8-18-19(10-14)27(36)30(26(18)35)24(29(38)39)23(25(40-30)16-5-9-20(31)21(32)11-16)28(37)34-17-6-3-15(4-7-17)22-12-41-13-33-22/h2-13,23-25H,1H3,(H,34,37)(H,38,39)/t23-,24-,25-,30+/m0/s1 |
| InChIKey | DSTZOLUPVHSYOH-DNHJLFCISA-N |
| XLogP | 6.27 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|