C22H14O4 — CID 58785375
2-[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol (PubChem CID 58785375) has the molecular formula C22H14O4 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol.
| Compound Name | 2-[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 58785375 |
| Molecular Formula | C22H14O4 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C#Cc2cccc(C#Cc3cc(O)ccc3O)c2)c1 |
| InChI | InChI=1S/C22H14O4/c23-19-8-10-21(25)17(13-19)6-4-15-2-1-3-16(12-15)5-7-18-14-20(24)9-11-22(18)26/h1-3,8-14,23-26H |
| InChIKey | XFQIXWQZDZSFHX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|