C10H16O2 — CID 58785471
1,3',3'-trimethylspiro[7-oxabicyclo[4.1.0]heptane-4,2'-oxirane] (PubChem CID 58785471) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,3',3'-trimethylspiro[7-oxabicyclo[4.1.0]heptane-4,2'-oxirane].
| Compound Name | 1,3',3'-trimethylspiro[7-oxabicyclo[4.1.0]heptane-4,2'-oxirane] |
|---|---|
| PubChem CID | 58785471 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1,3',3'-trimethylspiro[7-oxabicyclo[4.1.0]heptane-4,2'-oxirane] |
| SMILES | CC12CCC3(CC1O2)OC3(C)C |
| InChI | InChI=1S/C10H16O2/c1-8(2)10(12-8)5-4-9(3)7(6-10)11-9/h7H,4-6H2,1-3H3 |
| InChIKey | DHJQSGYSWNSFIL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|