C34H32N2O6S — CID 58785606
(5E)-3-[2-(2,4-dimethoxyphenyl)ethyl]-5-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 58785606) has the molecular formula C34H32N2O6S and a molecular weight of 596.70 g/mol. Its IUPAC name is (5E)-3-[2-(2,4-dimethoxyphenyl)ethyl]-5-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-[2-(2,4-dimethoxyphenyl)ethyl]-5-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 58785606 |
| Molecular Formula | C34H32N2O6S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | (5E)-3-[2-(2,4-dimethoxyphenyl)ethyl]-5-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | COc1ccc(N(c2ccc(/C=C3/OC(=S)N(CCc4ccc(OC)cc4OC)C3=O)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H32N2O6S/c1-38-28-15-10-26(11-16-28)36(27-12-17-29(39-2)18-13-27)25-8-5-23(6-9-25)21-32-33(37)35(34(43)42-32)20-19-24-7-14-30(40-3)22-31(24)41-4/h5-18,21-22H,19-20H2,1-4H3/b32-21+ |
| InChIKey | PIFYXHXHYYNING-RUMWWMSVSA-N |
| XLogP | 6.92 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|