About 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane
2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane (PubChem CID 58785768) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane.
Molecular Properties
| Compound Name | 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane |
| PubChem CID | 58785768 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane |
| SMILES | C=COC1C2CC3COC1C3O2 |
| InChI | InChI=1S/C9H12O3/c1-2-10-8-6-3-5-4-11-9(8)7(5)12-6/h2,5-9H,1,3-4H2 |
| InChIKey | KNQOEIGZXXLAES-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane (CID 58785768) is 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane is C=COC1C2CC3COC1C3O2.
What is the InChIKey of 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane?
The InChIKey is KNQOEIGZXXLAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-10-8-6-3-5-4-11-9(8)7(5)12-6/h2,5-9H,1,3-4H2.
What are the key properties of 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane?
2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane has a molecular weight of 168.19 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 58785768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).