C12H18N2O4 — CID 58785854
3-(2,5-dioxopyrrol-1-yl)-N-(2-propoxyethyl)propanamide (PubChem CID 58785854) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(2-propoxyethyl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(2-propoxyethyl)propanamide |
|---|---|
| PubChem CID | 58785854 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(2-propoxyethyl)propanamide |
| SMILES | CCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H18N2O4/c1-2-8-18-9-6-13-10(15)5-7-14-11(16)3-4-12(14)17/h3-4H,2,5-9H2,1H3,(H,13,15) |
| InChIKey | ASWGLSDBMYYAJM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|