About 2-(chloromethyl)azulene
2-(chloromethyl)azulene (PubChem CID 58786145) has the molecular formula C11H9Cl
and a molecular weight of 176.65 g/mol. Its IUPAC name is 2-(chloromethyl)azulene.
Molecular Properties
| Compound Name | 2-(chloromethyl)azulene |
| PubChem CID | 58786145 |
| Molecular Formula | C11H9Cl |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2-(chloromethyl)azulene |
| SMILES | ClCc1cc2cccccc-2c1 |
| InChI | InChI=1S/C11H9Cl/c12-8-9-6-10-4-2-1-3-5-11(10)7-9/h1-7H,8H2 |
| InChIKey | BSJGFUQAUZBOJH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)azulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)azulene?
The IUPAC name of 2-(chloromethyl)azulene (CID 58786145) is 2-(chloromethyl)azulene.
What is the SMILES notation for 2-(chloromethyl)azulene?
The canonical SMILES for 2-(chloromethyl)azulene is ClCc1cc2cccccc-2c1.
What is the InChIKey of 2-(chloromethyl)azulene?
The InChIKey is BSJGFUQAUZBOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl/c12-8-9-6-10-4-2-1-3-5-11(10)7-9/h1-7H,8H2.
What are the key properties of 2-(chloromethyl)azulene?
2-(chloromethyl)azulene has a molecular weight of 176.65 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)azulene is sourced from PubChem (CID 58786145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).