C25H26O8 — CID 58786224
2-[[2-methoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylic acid (PubChem CID 58786224) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylic acid.
| Compound Name | 2-[[2-methoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 58786224 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[[2-methoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylic acid |
| SMILES | COc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1cc2cccccc-2c1C(=O)O |
| InChI | InChI=1S/C25H26O8/c1-32-18-8-7-14(24-23(29)22(28)21(27)19(12-26)33-24)10-15(18)11-16-9-13-5-3-2-4-6-17(13)20(16)25(30)31/h2-10,19,21-24,26-29H,11-12H2,1H3,(H,30,31)/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | TXEJXHHTYMUKOA-ZXGKGEBGSA-N |
| XLogP | 1.60 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |