C24H33ClF3N7O — CID 58787027
2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 58787027) has the molecular formula C24H33ClF3N7O and a molecular weight of 528.02 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 58787027 |
| Molecular Formula | C24H33ClF3N7O |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(NCC2CCCCC2)nc(Nc2ccc(OC(F)(F)F)c(Cl)c2)n1 |
| InChI | InChI=1S/C24H33ClF3N7O/c1-2-35-12-6-9-18(35)15-30-22-32-21(29-14-16-7-4-3-5-8-16)33-23(34-22)31-17-10-11-20(19(25)13-17)36-24(26,27)28/h10-11,13,16,18H,2-9,12,14-15H2,1H3,(H3,29,30,31,32,33,34) |
| InChIKey | HKELYBGSNKWQCP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |