About 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine
2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine (PubChem CID 58787092) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine.
Analyze 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine?
The IUPAC name of 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine (CID 58787092) is 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine.
What is the SMILES notation for 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine?
The canonical SMILES for 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine is CCC1CN(C)C2C=CC=CC2O1.
What is the InChIKey of 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine?
The InChIKey is YPYFAVJGZLFNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-9-8-12(2)10-6-4-5-7-11(10)13-9/h4-7,9-11H,3,8H2,1-2H3.
What are the key properties of 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine?
2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine has a molecular weight of 179.26 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methyl-2,3,4a,8a-tetrahydro-1,4-benzoxazine is sourced from PubChem (CID 58787092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).