C11H15FO — CID 58787098
2-ethyl-6-fluoro-3,4,4a,8a-tetrahydro-2H-chromene (PubChem CID 58787098) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-3,4,4a,8a-tetrahydro-2H-chromene.
| Compound Name | 2-ethyl-6-fluoro-3,4,4a,8a-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 58787098 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-ethyl-6-fluoro-3,4,4a,8a-tetrahydro-2H-chromene |
| SMILES | CCC1CCC2C=C(F)C=CC2O1 |
| InChI | InChI=1S/C11H15FO/c1-2-10-5-3-8-7-9(12)4-6-11(8)13-10/h4,6-8,10-11H,2-3,5H2,1H3 |
| InChIKey | YQDJZEXSFHPFCX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |