C11H24N6O — CID 58787799
1-(diaminomethylidene)-2-[(2S)-4-methyl-3-oxo-2-(propan-2-ylamino)pentyl]guanidine (PubChem CID 58787799) has the molecular formula C11H24N6O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[(2S)-4-methyl-3-oxo-2-(propan-2-ylamino)pentyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[(2S)-4-methyl-3-oxo-2-(propan-2-ylamino)pentyl]guanidine |
|---|---|
| PubChem CID | 58787799 |
| Molecular Formula | C11H24N6O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1-(diaminomethylidene)-2-[(2S)-4-methyl-3-oxo-2-(propan-2-ylamino)pentyl]guanidine |
| SMILES | CC(C)N[C@@H](C/N=C(\N)N=C(N)N)C(=O)C(C)C |
| InChI | InChI=1S/C11H24N6O/c1-6(2)9(18)8(16-7(3)4)5-15-11(14)17-10(12)13/h6-8,16H,5H2,1-4H3,(H6,12,13,14,15,17)/t8-/m0/s1 |
| InChIKey | OUCVEGOZOKOFQA-QMMMGPOBSA-N |
| XLogP | -0.83 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|