About 4-methylidenequinolizine
4-methylidenequinolizine (PubChem CID 58788768) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-methylidenequinolizine.
Molecular Properties
| Compound Name | 4-methylidenequinolizine |
| PubChem CID | 58788768 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 4-methylidenequinolizine |
| SMILES | C=C1C=CC=C2C=CC=CN12 |
| InChI | InChI=1S/C10H9N/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H2 |
| InChIKey | COTBTTVFDIQZQI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylidenequinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidenequinolizine?
The IUPAC name of 4-methylidenequinolizine (CID 58788768) is 4-methylidenequinolizine.
What is the SMILES notation for 4-methylidenequinolizine?
The canonical SMILES for 4-methylidenequinolizine is C=C1C=CC=C2C=CC=CN12.
What is the InChIKey of 4-methylidenequinolizine?
The InChIKey is COTBTTVFDIQZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H2.
What are the key properties of 4-methylidenequinolizine?
4-methylidenequinolizine has a molecular weight of 143.19 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidenequinolizine is sourced from PubChem (CID 58788768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).