C11H11F9NO+ — CID 58788815
1-[1-ethyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-ium-1-yl]prop-2-en-1-one (PubChem CID 58788815) has the molecular formula C11H11F9NO+ and a molecular weight of 344.20 g/mol. Its IUPAC name is 1-[1-ethyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-ium-1-yl]prop-2-en-1-one.
| Compound Name | 1-[1-ethyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58788815 |
| Molecular Formula | C11H11F9NO+ |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[1-ethyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aziridin-1-ium-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[N+]1(CC)CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9NO/c1-3-7(22)21(4-2)5-6(21)8(12,13)9(14,15)10(16,17)11(18,19)20/h3,6H,1,4-5H2,2H3/q+1 |
| InChIKey | BHJJLCWYUFZVSC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|