C17H16F10O5 — CID 58789597
[2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58789597) has the molecular formula C17H16F10O5 and a molecular weight of 490.29 g/mol. Its IUPAC name is [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58789597 |
| Molecular Formula | C17H16F10O5 |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F)CC2C=CC1C2 |
| InChI | InChI=1S/C17H16F10O5/c1-13(5-7-2-3-8(13)4-7)12(29)31-6-9(28)32-10(16(22,23)24)15(20,21)14(30,11(18)19)17(25,26)27/h2-3,7-8,10-11,30H,4-6H2,1H3 |
| InChIKey | ZDQJIDWYAPNPDN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|