C15H14F10O3 — CID 58789603
[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58789603) has the molecular formula C15H14F10O3 and a molecular weight of 432.25 g/mol. Its IUPAC name is [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58789603 |
| Molecular Formula | C15H14F10O3 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl] 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C(=O)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F)CC2C=CC1C2 |
| InChI | InChI=1S/C15H14F10O3/c1-11(5-6-2-3-7(11)4-6)10(26)28-8(14(20,21)22)13(18,19)12(27,9(16)17)15(23,24)25/h2-3,6-9,27H,4-5H2,1H3 |
| InChIKey | JSBHAZWSMWWYNL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|