C16H14F10O5 — CID 58789604
[2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58789604) has the molecular formula C16H14F10O5 and a molecular weight of 476.26 g/mol. Its IUPAC name is [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58789604 |
| Molecular Formula | C16H14F10O5 |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [2-[4-(difluoromethyl)-1,1,1,3,3,5,5,5-octafluoro-4-hydroxypentan-2-yl]oxy-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)C1CC2C=CC1C2)OC(C(F)(F)F)C(F)(F)C(O)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F10O5/c17-12(18)13(29,16(24,25)26)14(19,20)11(15(21,22)23)31-9(27)5-30-10(28)8-4-6-1-2-7(8)3-6/h1-2,6-8,11-12,29H,3-5H2 |
| InChIKey | BDCRXNVVNQNENS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|