About (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide
(Z)-N-tert-butyl-4,4-dimethylpent-2-enamide (PubChem CID 58790434) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide |
| PubChem CID | 58790434 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)/C=C\C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H21NO/c1-10(2,3)8-7-9(13)12-11(4,5)6/h7-8H,1-6H3,(H,12,13)/b8-7- |
| InChIKey | DLZPTINIKKJUMW-FPLPWBNLSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide?
The IUPAC name of (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide (CID 58790434) is (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide.
What is the SMILES notation for (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide?
The canonical SMILES for (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide is CC(C)(C)/C=C\C(=O)NC(C)(C)C.
What is the InChIKey of (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide?
The InChIKey is DLZPTINIKKJUMW-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H21NO/c1-10(2,3)8-7-9(13)12-11(4,5)6/h7-8H,1-6H3,(H,12,13)/b8-7-.
What are the key properties of (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide?
(Z)-N-tert-butyl-4,4-dimethylpent-2-enamide has a molecular weight of 183.29 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-tert-butyl-4,4-dimethylpent-2-enamide is sourced from PubChem (CID 58790434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).