C34H32N4O4S2 — CID 58790543
[3-[4-[4-(dimethylamino)butanoyl-methylamino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate (PubChem CID 58790543) has the molecular formula C34H32N4O4S2 and a molecular weight of 624.79 g/mol. Its IUPAC name is [3-[4-[4-(dimethylamino)butanoyl-methylamino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate.
| Compound Name | [3-[4-[4-(dimethylamino)butanoyl-methylamino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate |
|---|---|
| PubChem CID | 58790543 |
| Molecular Formula | C34H32N4O4S2 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | [3-[4-[4-(dimethylamino)butanoyl-methylamino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfonate |
| SMILES | CN(C)CCCC(=O)N(C)c1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5cccs5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32N4O4S2/c1-37(2)19-7-11-30(39)38(3)25-15-13-23(14-16-25)28-22-35-34-33(32(28)24-9-5-4-6-10-24)27-21-26(17-18-29(27)36-34)42-44(40,41)31-12-8-20-43-31/h4-6,8-10,12-18,20-22H,7,11,19H2,1-3H3,(H,35,36) |
| InChIKey | BUKJWJLQOMMDTC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|