About [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate
[3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate (PubChem CID 58790670) has the molecular formula C28H19N3O5S
and a molecular weight of 509.54 g/mol. Its IUPAC name is [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate.
Molecular Properties
| Compound Name | [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate |
| PubChem CID | 58790670 |
| Molecular Formula | C28H19N3O5S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate |
| SMILES | O=CNc1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5ccco5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H19N3O5S/c32-17-30-20-10-8-18(9-11-20)23-16-29-28-27(26(23)19-5-2-1-3-6-19)22-15-21(12-13-24(22)31-28)36-37(33,34)25-7-4-14-35-25/h1-17H,(H,29,31)(H,30,32) |
| InChIKey | NYVQREZIRAEKCP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate?
The IUPAC name of [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate (CID 58790670) is [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate.
What is the SMILES notation for [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate?
The canonical SMILES for [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate is O=CNc1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5ccco5)cc4c3c2-c2ccccc2)cc1.
What is the InChIKey of [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate?
The InChIKey is NYVQREZIRAEKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19N3O5S/c32-17-30-20-10-8-18(9-11-20)23-16-29-28-27(26(23)19-5-2-1-3-6-19)22-15-21(12-13-24(22)31-28)36-37(33,34)25-7-4-14-35-25/h1-17H,(H,29,31)(H,30,32).
What are the key properties of [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate?
[3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate has a molecular weight of 509.54 g/mol, XLogP of 5.98, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-formamidophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate is sourced from PubChem (CID 58790670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).