About methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate
methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate (PubChem CID 58790813) has the molecular formula C25H18FN3O2
and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate |
| PubChem CID | 58790813 |
| Molecular Formula | C25H18FN3O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cnc3[nH]c4ccc(N)cc4c3c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H18FN3O2/c1-31-25(30)16-4-2-14(3-5-16)20-13-28-24-23(19-12-18(27)10-11-21(19)29-24)22(20)15-6-8-17(26)9-7-15/h2-13H,27H2,1H3,(H,28,29) |
| InChIKey | NOBXXTITEPFETG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The IUPAC name of methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate (CID 58790813) is methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate.
What is the SMILES notation for methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The canonical SMILES for methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate is COC(=O)c1ccc(-c2cnc3[nH]c4ccc(N)cc4c3c2-c2ccc(F)cc2)cc1.
What is the InChIKey of methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The InChIKey is NOBXXTITEPFETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18FN3O2/c1-31-25(30)16-4-2-14(3-5-16)20-13-28-24-23(19-12-18(27)10-11-21(19)29-24)22(20)15-6-8-17(26)9-7-15/h2-13H,27H2,1H3,(H,28,29).
What are the key properties of methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate?
methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate has a molecular weight of 411.44 g/mol, XLogP of 5.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[6-amino-4-(4-fluorophenyl)-9H-pyrido[2,3-b]indol-3-yl]benzoate is sourced from PubChem (CID 58790813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).