About methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate
methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate (PubChem CID 58790824) has the molecular formula C31H22N2O5S
and a molecular weight of 534.59 g/mol. Its IUPAC name is methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate |
| PubChem CID | 58790824 |
| Molecular Formula | C31H22N2O5S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5ccccc5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H22N2O5S/c1-37-31(34)22-14-12-20(13-15-22)26-19-32-30-29(28(26)21-8-4-2-5-9-21)25-18-23(16-17-27(25)33-30)38-39(35,36)24-10-6-3-7-11-24/h2-19H,1H3,(H,32,33) |
| InChIKey | HXNGYLDLSYSTAS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The IUPAC name of methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate (CID 58790824) is methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate.
What is the SMILES notation for methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The canonical SMILES for methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate is COC(=O)c1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5ccccc5)cc4c3c2-c2ccccc2)cc1.
What is the InChIKey of methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate?
The InChIKey is HXNGYLDLSYSTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22N2O5S/c1-37-31(34)22-14-12-20(13-15-22)26-19-32-30-29(28(26)21-8-4-2-5-9-21)25-18-23(16-17-27(25)33-30)38-39(35,36)24-10-6-3-7-11-24/h2-19H,1H3,(H,32,33).
What are the key properties of methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate?
methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate has a molecular weight of 534.59 g/mol, XLogP of 6.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[6-(benzenesulfonyloxy)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzoate is sourced from PubChem (CID 58790824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).