C39H34N4O5S2 — CID 58790915
N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfonamide (PubChem CID 58790915) has the molecular formula C39H34N4O5S2 and a molecular weight of 702.86 g/mol. Its IUPAC name is N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfonamide.
| Compound Name | N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 58790915 |
| Molecular Formula | C39H34N4O5S2 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfonamide |
| SMILES | CN(c1ccc(-c2cnc3[nH]c4ccc(CS(=O)(=O)c5ccccc5)cc4c3c2-c2ccccc2)cc1)S(=O)(=O)CCCOc1ccccn1 |
| InChI | InChI=1S/C39H34N4O5S2/c1-43(50(46,47)24-10-23-48-36-15-8-9-22-40-36)31-19-17-29(18-20-31)34-26-41-39-38(37(34)30-11-4-2-5-12-30)33-25-28(16-21-35(33)42-39)27-49(44,45)32-13-6-3-7-14-32/h2-9,11-22,25-26H,10,23-24,27H2,1H3,(H,41,42) |
| InChIKey | GPTDHSLHAJJGOW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|