About (4-aminophenyl) thiophene-2-sulfonate
(4-aminophenyl) thiophene-2-sulfonate (PubChem CID 58791015) has the molecular formula C10H9NO3S2
and a molecular weight of 255.32 g/mol. Its IUPAC name is (4-aminophenyl) thiophene-2-sulfonate.
Molecular Properties
| Compound Name | (4-aminophenyl) thiophene-2-sulfonate |
| PubChem CID | 58791015 |
| Molecular Formula | C10H9NO3S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | (4-aminophenyl) thiophene-2-sulfonate |
| SMILES | Nc1ccc(OS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C10H9NO3S2/c11-8-3-5-9(6-4-8)14-16(12,13)10-2-1-7-15-10/h1-7H,11H2 |
| InChIKey | DLBZWXYZFFSPPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) thiophene-2-sulfonate?
The IUPAC name of (4-aminophenyl) thiophene-2-sulfonate (CID 58791015) is (4-aminophenyl) thiophene-2-sulfonate.
What is the SMILES notation for (4-aminophenyl) thiophene-2-sulfonate?
The canonical SMILES for (4-aminophenyl) thiophene-2-sulfonate is Nc1ccc(OS(=O)(=O)c2cccs2)cc1.
What is the InChIKey of (4-aminophenyl) thiophene-2-sulfonate?
The InChIKey is DLBZWXYZFFSPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3S2/c11-8-3-5-9(6-4-8)14-16(12,13)10-2-1-7-15-10/h1-7H,11H2.
What are the key properties of (4-aminophenyl) thiophene-2-sulfonate?
(4-aminophenyl) thiophene-2-sulfonate has a molecular weight of 255.32 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) thiophene-2-sulfonate is sourced from PubChem (CID 58791015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).