C40H35N3O5S2 — CID 58791061
N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-phenoxypropane-1-sulfonamide (PubChem CID 58791061) has the molecular formula C40H35N3O5S2 and a molecular weight of 701.87 g/mol. Its IUPAC name is N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-phenoxypropane-1-sulfonamide.
| Compound Name | N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-phenoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 58791061 |
| Molecular Formula | C40H35N3O5S2 |
| Molecular Weight | 701.87 g/mol |
| Exact Mass | 701.20 |
| IUPAC Name | N-[4-[6-(benzenesulfonylmethyl)-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-phenoxypropane-1-sulfonamide |
| SMILES | CN(c1ccc(-c2cnc3[nH]c4ccc(CS(=O)(=O)c5ccccc5)cc4c3c2-c2ccccc2)cc1)S(=O)(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C40H35N3O5S2/c1-43(50(46,47)25-11-24-48-33-14-7-3-8-15-33)32-21-19-30(20-22-32)36-27-41-40-39(38(36)31-12-5-2-6-13-31)35-26-29(18-23-37(35)42-40)28-49(44,45)34-16-9-4-10-17-34/h2-10,12-23,26-27H,11,24-25,28H2,1H3,(H,41,42) |
| InChIKey | HNQOTOLYGBRGBD-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.87 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|