About 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole
6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole (PubChem CID 58791071) has the molecular formula C23H23BrN4O2S
and a molecular weight of 499.43 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole |
| PubChem CID | 58791071 |
| Molecular Formula | C23H23BrN4O2S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole |
| SMILES | CN1CCN(c2c(Br)cnc3[nH]c4ccc(CS(=O)(=O)c5ccccc5)cc4c23)CC1 |
| InChI | InChI=1S/C23H23BrN4O2S/c1-27-9-11-28(12-10-27)22-19(24)14-25-23-21(22)18-13-16(7-8-20(18)26-23)15-31(29,30)17-5-3-2-4-6-17/h2-8,13-14H,9-12,15H2,1H3,(H,25,26) |
| InChIKey | GAJZHUJQYTUQAW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole?
The IUPAC name of 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole (CID 58791071) is 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole?
The canonical SMILES for 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole is CN1CCN(c2c(Br)cnc3[nH]c4ccc(CS(=O)(=O)c5ccccc5)cc4c23)CC1.
What is the InChIKey of 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole?
The InChIKey is GAJZHUJQYTUQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23BrN4O2S/c1-27-9-11-28(12-10-27)22-19(24)14-25-23-21(22)18-13-16(7-8-20(18)26-23)15-31(29,30)17-5-3-2-4-6-17/h2-8,13-14H,9-12,15H2,1H3,(H,25,26).
What are the key properties of 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole?
6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole has a molecular weight of 499.43 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzenesulfonylmethyl)-3-bromo-4-(4-methylpiperazin-1-yl)-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 58791071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).