C23H25F3N4O2S — CID 58791217
N,N-dimethyl-6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxamide (PubChem CID 58791217) has the molecular formula C23H25F3N4O2S and a molecular weight of 478.54 g/mol. Its IUPAC name is N,N-dimethyl-6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58791217 |
| Molecular Formula | C23H25F3N4O2S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N,N-dimethyl-6-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-3-carboxamide |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(C(=O)N(C)C)cn3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H25F3N4O2S/c1-4-5-6-11-32-20-10-8-16(12-17(20)23(24,25)26)28-22-29-19(14-33-22)18-9-7-15(13-27-18)21(31)30(2)3/h7-10,12-14H,4-6,11H2,1-3H3,(H,28,29) |
| InChIKey | WJGMNNDEMUPTBE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|