About 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide
2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 58791264) has the molecular formula C21H21F3N4O2S
and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| PubChem CID | 58791264 |
| Molecular Formula | C21H21F3N4O2S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCOc1ccc(Nc2nc(C(=O)Nc3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3N4O2S/c1-2-3-4-10-30-18-8-7-14(11-16(18)21(22,23)24)27-20-28-17(13-31-20)19(29)26-15-6-5-9-25-12-15/h5-9,11-13H,2-4,10H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | AMKIQPNOWPQQFN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide (CID 58791264) is 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide is CCCCCOc1ccc(Nc2nc(C(=O)Nc3cccnc3)cs2)cc1C(F)(F)F.
What is the InChIKey of 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide?
The InChIKey is AMKIQPNOWPQQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3N4O2S/c1-2-3-4-10-30-18-8-7-14(11-16(18)21(22,23)24)27-20-28-17(13-31-20)19(29)26-15-6-5-9-25-12-15/h5-9,11-13H,2-4,10H2,1H3,(H,26,29)(H,27,28).
What are the key properties of 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide?
2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide has a molecular weight of 450.49 g/mol, XLogP of 6.12, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-pentoxy-3-(trifluoromethyl)anilino]-N-pyridin-3-yl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 58791264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).