C23H21F3N4OS2 — CID 58791346
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-(2-pyridin-3-yl-1,3-thiazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 58791346) has the molecular formula C23H21F3N4OS2 and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-(2-pyridin-3-yl-1,3-thiazol-4-yl)-1,3-thiazol-2-amine.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-(2-pyridin-3-yl-1,3-thiazol-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791346 |
| Molecular Formula | C23H21F3N4OS2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-(2-pyridin-3-yl-1,3-thiazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3csc(-c4cccnc4)n3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N4OS2/c1-2-3-4-10-31-20-8-7-16(11-17(20)23(24,25)26)28-22-30-19(14-33-22)18-13-32-21(29-18)15-6-5-9-27-12-15/h5-9,11-14H,2-4,10H2,1H3,(H,28,30) |
| InChIKey | HQSAMIJIGPXPEM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|