C24H27F4N3OS — CID 58791358
4-(4-fluorophenyl)-2-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazole-2,5-diamine (PubChem CID 58791358) has the molecular formula C24H27F4N3OS and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazole-2,5-diamine.
| Compound Name | 4-(4-fluorophenyl)-2-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 58791358 |
| Molecular Formula | C24H27F4N3OS |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 4-(4-fluorophenyl)-2-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazole-2,5-diamine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3ccc(F)cc3)c(N)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H27F4N3OS/c1-2-3-4-5-6-7-14-32-20-13-12-18(15-19(20)24(26,27)28)30-23-31-21(22(29)33-23)16-8-10-17(25)11-9-16/h8-13,15H,2-7,14,29H2,1H3,(H,30,31) |
| InChIKey | YSMBDJBOWIRHFO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|