About N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine
N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791376) has the molecular formula C27H28F3N3OS
and a molecular weight of 499.60 g/mol. Its IUPAC name is N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine |
| PubChem CID | 58791376 |
| Molecular Formula | C27H28F3N3OS |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3cnc4ccccc4c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H28F3N3OS/c1-2-3-4-5-6-9-14-34-25-13-12-21(16-22(25)27(28,29)30)32-26-33-24(18-35-26)20-15-19-10-7-8-11-23(19)31-17-20/h7-8,10-13,15-18H,2-6,9,14H2,1H3,(H,32,33) |
| InChIKey | LZGXGWQAYNPPOG-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine?
The IUPAC name of N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine (CID 58791376) is N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine?
The canonical SMILES for N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine is CCCCCCCCOc1ccc(Nc2nc(-c3cnc4ccccc4c3)cs2)cc1C(F)(F)F.
What is the InChIKey of N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine?
The InChIKey is LZGXGWQAYNPPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28F3N3OS/c1-2-3-4-5-6-9-14-34-25-13-12-21(16-22(25)27(28,29)30)32-26-33-24(18-35-26)20-15-19-10-7-8-11-23(19)31-17-20/h7-8,10-13,15-18H,2-6,9,14H2,1H3,(H,32,33).
What are the key properties of N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine?
N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine has a molecular weight of 499.60 g/mol, XLogP of 8.86, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-octoxy-3-(trifluoromethyl)phenyl]-4-quinolin-3-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 58791376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).