About 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine
4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 58791380) has the molecular formula C22H28N4OS
and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine |
| PubChem CID | 58791380 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3ccc(C)nc3)cs2)cn1 |
| InChI | InChI=1S/C22H28N4OS/c1-3-4-5-6-7-8-13-27-21-12-11-19(15-24-21)25-22-26-20(16-28-22)18-10-9-17(2)23-14-18/h9-12,14-16H,3-8,13H2,1-2H3,(H,25,26) |
| InChIKey | KJFPFFMXKJNERA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine (CID 58791380) is 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine is CCCCCCCCOc1ccc(Nc2nc(-c3ccc(C)nc3)cs2)cn1.
What is the InChIKey of 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine?
The InChIKey is KJFPFFMXKJNERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4OS/c1-3-4-5-6-7-8-13-27-21-12-11-19(15-24-21)25-22-26-20(16-28-22)18-10-9-17(2)23-14-18/h9-12,14-16H,3-8,13H2,1-2H3,(H,25,26).
What are the key properties of 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine?
4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine has a molecular weight of 396.56 g/mol, XLogP of 6.39, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-3-pyridinyl)-N-(6-octoxy-3-pyridinyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 58791380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).