C24H26F3N5O3S — CID 58791395
N-(2-amino-2-oxoethyl)-N-methyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide (PubChem CID 58791395) has the molecular formula C24H26F3N5O3S and a molecular weight of 521.57 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-methyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-methyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58791395 |
| Molecular Formula | C24H26F3N5O3S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-methyl-5-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(C(=O)N(C)CC(N)=O)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H26F3N5O3S/c1-3-4-5-10-35-20-9-7-16(11-17(20)24(25,26)27)30-23-31-19(14-36-23)15-6-8-18(29-12-15)22(34)32(2)13-21(28)33/h6-9,11-12,14H,3-5,10,13H2,1-2H3,(H2,28,33)(H,30,31) |
| InChIKey | TWGOJZUEOLGWCN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|